| General Information | |
|---|---|
| ZINC ID | nabilone |
| Molecular Weight (Da) | 372 |
| SMILES | CCCCCCC(c1cc(O)c2c(c1)OC(C1C2CC(=O)CC1)(C)C)(C)C |
| Molecular Formula | C24H36O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.89 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| LogP | 6.26 |
| Activity (Ki) in nM | 3.9811 |
| Polar Surface Area (PSA) | 46.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.90908753 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.71 |
| Ilogp | 3.96 |
| Xlogp3 | 7.44 |
| Wlogp | 6.26 |
| Mlogp | 4.16 |
| Silicos-it log p | 6.28 |
| Consensus log p | 5.62 |
| Esol log s | -6.61 |
| Esol solubility (mg/ml) | 0.0000924 |
| Esol solubility (mol/l) | 0.00000024 |
| Esol class | Poorly sol |
| Ali log s | -8.25 |
| Ali solubility (mg/ml) | 0.0000021 |
| Ali solubility (mol/l) | 5.64E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.87 |
| Silicos-it solubility (mg/ml) | 0.0000501 |
| Silicos-it solubility (mol/l) | 0.00000013 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.29 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.35 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.849 |
| Logd | 5.387 |
| Logp | 7.298 |
| F (20%) | 0.999 |
| F (30%) | 0.997 |
| Mdck | - |
| Ppb | 99.48% |
| Vdss | 4.391 |
| Fu | 1.50% |
| Cyp1a2-inh | 0.105 |
| Cyp1a2-sub | 0.917 |
| Cyp2c19-inh | 0.523 |
| Cyp2c19-sub | 0.909 |
| Cl | 3.803 |
| T12 | 0.083 |
| H-ht | 0.249 |
| Dili | 0.126 |
| Roa | 0.233 |
| Fdamdd | 0.799 |
| Skinsen | 0.11 |
| Ec | 0.003 |
| Ei | 0.026 |
| Respiratory | 0.942 |
| Bcf | 1.882 |
| Igc50 | 5.112 |
| Lc50 | 5.497 |
| Lc50dm | 5.697 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.09 |
| Nr-aromatase | 0.899 |
| Nr-er | 0.538 |
| Nr-er-lbd | 0.813 |
| Nr-ppar-gamma | 0.953 |
| Sr-are | 0.514 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.412 |
| Sr-mmp | 0.984 |
| Sr-p53 | 0.569 |
| Vol | 413.816 |
| Dense | 0.9 |
| Flex | 0.353 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.599 |
| Synth | 3.581 |
| Fsp3 | 0.708 |
| Mce-18 | 72.439 |
| Natural product-likeness | 1.722 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |